Gemcitabine
Gemcitabine is a DNA synthesis inhibitor with IC50 of 50 nM, 40 nM, 18 nM and 12 nM in PANC1, MIAPaCa2, BxPC3 and Capan2 cells, respectively.
| Trivial name | LY-188011; NSC-613327 |
| Catalog Number | CSN11086 |
| Alternative Name(s) | LY-188011; NSC-613327 |
| Research Area | Cancer |
| Molecular Formula | C9H11F2N3O4 |
| CAS# | 95058-81-4 |
| Purity | ≥99% |
| SMILES | [C@H]2(N1C(N=C(N)C=C1)=O)C([C@H](O)[C@H](O2)CO)(F)F |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/gemcitabine.html |
