(25S)-Δ7-Dafachronic acid | MedChemExpress (MCE)
(25S)-Δ7-Dafachronic acid is a ligand and activator of DAF-12 receptor. DAF-12 is a nuclear hormone receptor that regulates larval diapause, developmental age, and adult longevity in Caenorhabditis elegans[1][2][3].

Trivial name | (25S)-Δ7-Dafachronic acid |
Catalog Number | HY-130221 |
Alternative Name(s) | Dafachronic acid A; Δ7-Dafachronic acid |
Research Area | Others |
CAS# | 949004-12-0 |
Purity | ≥98.0% |
SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCC[C@H](C)C(O)=O)([H])C3=CC[C@](CC(CC4)=O)([H])[C@@]4(C)[C@@]3([H])CC1 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/25s-7-dafachronic-acid.html |