Tie2 kinase-IN-1
Tie2 kinase inhibitor is an optimized compound of SB-203580, selective to Tie2 with IC50 of 0.25 μM, 200-fold more potent than p38.
| Trivial name | Tie2 Kinase Inhibitor |
| Catalog Number | CSN16555 |
| Alternative Name(s) | Tie2 Kinase Inhibitor |
| Research Area | Cancer |
| Molecular Formula | C26H21N3O2S |
| CAS# | 948557-43-5 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC=C(C2=NC(C3=CC=C4C=C(OC)C=CC4=C3)=C(C5=CC=NC=C5)N2)C=C1)C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tie2-kinase-in-1.html |