Sulfoxaflor
Pesticide Standards
| Trivial name | NULL |
| Catalog Number | CS-T-61546 |
| Alternative Name(s) | Methyl[1-(2-trifluoromethylpyridin-5-yl)ethyl]-N-cyanosulfoximine |
| Research Area | Sulfoxaflor, is a new insecticide which acts as an insect neurotoxin, and is the only member of class of chemicals called the sulfoximines which act on the central nervous system of insects with much lower toxicity to mammals. |
| Molecular Formula | C10H10F3N3OS |
| CAS# | 946578-00-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C1=CN=C(C(F)(F)F)C=C1)[S](=[15N][13C]#[15N])(C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST61546.html |
| Additional Information | NULL |