RN-1734
RN-1734 (TRPV4 Antagonist I) is a selective transient receptor potential vanilloid 4 (TRPV4) antagonist with IC50 of 2.3 μM, 5.9 μM and 3.2 μM for hTRPV4, mTRPV4 and rTRPV4, respectively. RN-1734 alleviates demyelination and inhibits glial activation and the production of tumor necrosis factor α (TNF-α) and interleukin 1β (IL-1β) without altering the number of olig2-positive cells.
| Trivial name | TRPV4 Antagonist I |
| Catalog Number | S2650 |
| Molecular Formula | C17H13Cl2NO4 |
| CAS# | 946387-07-1 |
| Inchi | InChI=1S/C17H13Cl2NO4/c1-24-10-4-2-9(3-5-10)13(21)8-17(23)14-11(18)6-7-12(19)15(14)20-16(17)22/h2-7,23H,8H2,1H3,(H,20,22) |
| Inchi Key | HLXSCTYHLQHQDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC2(C3=C(C=CC(=C3NC2=O)Cl)Cl)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/rn-1734.html |
| Additional Information | https://file.selleck.cn/downloads/struct/rn-1734-chemical-structure-s2650.gif |