RN-1734
RN-1734 is selective antagonist of the TRPV4 channel, completely antagonizes 4αPDD-mediated activation of TRPV4 with comparable, low micromolar IC50 values for all three species (hTRPV4: IC50 = 2.3 μM, mTRPV4: IC50 = 5.9 μM, rTRPV4: IC50 = 3.2 μM).
| Trivial name | / |
| Catalog Number | CSN18624 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C14H22Cl2N2O2S |
| CAS# | 946387-07-1 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC=C(Cl)C=C1Cl)(N(C(C)C)CCNC(C)C)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/rn-1734.html |