Ophiopogonin D
Ophiopogonin D, a natural product isolated and purified from Radix Ophiopogon japonicus, protects the heart against doxorubicin-induced autophagic injury by reduction of both ROS generation and the disruption of the mitochondrial membrane damage.
| Trivial name | Ophiopogonin-D |
| Catalog Number | CSN14079 |
| Alternative Name(s) | Ophiopogonin-D |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C44H70O16 |
| CAS# | 945619-74-9 |
| Purity | ≥99% |
| SMILES | C[C@@]12[C@@]3([C@]([H])(C[C@]1([C@]4([C@]([H])(CC2)[C@@]5(C)[C@H](O[C@]6([C@H](O[C@]7([C@H](O)[C@H](O)[C@H]([C@@H](O7)C)O)[H])[C@@H](O[C@]8([C@H](O)[C@@H](O)[C@@H](CO8)O)[H])[C@H]([C@H](O6)C)O)[H])C[C@@H](CC5=CC4)O)[H])[H])O[C@@]9([C@H]3C)CC[C@H](CO9)C)[H] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/ophiopogonin-d.html |