Lck Inhibitor 2
Lck inhibitor 2 is a bis-anilinopyrimidine inhibitor of tyrosine kinases including LCK, BTK, LYN, SYK, and TXK. The IC50 values are 13nM, 9nM, 3nM, 26nM and 2nM for Lck, Btk, Lyn, Btk and Txk respectively.
| Trivial name | / |
| Catalog Number | CSN18620 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C18H17N5O2 |
| CAS# | 944795-06-6 |
| Purity | ≥98% |
| SMILES | OC1=CC=C(C)C(NC2=CC=NC(NC3=CC(C(N)=O)=CC=C3)=N2)=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/lck-inhibitor-2.html |