CCT129202 10mg
CCT129202 is a representative of a structurally novel series of imidazopyridine small-molecule inhibitors of Aurora kinase activity. It shows high selectivity for the Aurora kinases over a panel of other kinases tested and inhibits proliferation in multiple cultured human tumor cell lines.
| Trivial name | CCT129202 10mg |
| Catalog Number | A10184-10 |
| Alternative Name(s) | 2-[4-[6-Chloro-2-(4-dimethylaminophenyl)-3H-imidazo[4,5-b]pyridin-7-yl]piperazin-1-yl]-N-(thiazol-2-yl)acetamide |
| Molecular Formula | C23H25ClN8OS |
| CAS# | 942947-93-5 |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=NC=C(C(=C3N2)N4CCN(CC4)CC(=O)NC5=NC=CS5)Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/cct129202.html |
