SB743921
Potent KSP inhibitor Cell Cycle/Checkpoint|Ksp
| Catalog Number | B1590-50 |
| Research Area | Cell Cycle/Checkpoint|Ksp |
| Molecular Formula | C31H34Cl2N2O3 |
| CAS# | 940929-33-9 |
| Purity | 96.32% |
| SMILES | CC1=CC=C(C=C1)C(=O)N(CCCN)C(C2=C(C(=O)C3=C(O2)C=C(C=C3)Cl)CC4=CC=CC=C4)C(C)C.Cl |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1590 |
