Poliumoside
Poliumoside exhibits significant inhibition of advanced glycation end product formation with IC50 values of 19.69 µM. In the rat lens aldose reductase assay.Poliumoside exhibits greater inhibitory effects on rat lens aldose reductase(RLAR) with IC50 values of 8.47 µM.
| Trivial name | N/A |
| Catalog Number | S1074 |
| Molecular Formula | C18H16N2O |
| CAS# | 94079-81-9 |
| SMILES | CC1=CC=C(N=NC2=C3C=CC=CC3=CC=C2O)C(=C1)C |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/poliumoside.html |
| Additional Information | https://file.selleck.cn/downloads/struct/poliumoside-chemical-structure-s1074.gif |
