NVP-BHG712 10mM * 1mL in DMSO
NVP-BHG712 is a selective inhibitor of EphB4 kinase that exhibits selectivity for EphB4 over more than 40 other kinases in vitro, including FGFR3.
| Trivial name | NVP-BHG712 10mM * 1mL in DMSO |
| Catalog Number | A10661-10mM-D |
| Alternative Name(s) | 4-Methyl-3-[[1-methyl-6-(3-pyridiny l)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]amino]-N-[3-(t rifluoromethyl)phenyl]benzamide trifluoroacetate |
| Molecular Formula | C26H20F3N7O |
| CAS# | 940310-85-0 |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CC=CC(=C2)C(F)(F)F)NC3=NC(=NC4=C3C=NN4C)C5=CN=CC=C5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/nvp-bhg712.html |
