Chalcone
Chalcone is isolated from Glycyrrhizae inflata and used to synthesize chalcone derivatives. Chalcone derivatives possess varied biological and pharmacological activity, including anti-inflammatory, antioxidative, antibacterial, anticancer, and anti-parasitic activities.
| Trivial name | / |
| Catalog Number | CSN27378 |
| Alternative Name(s) | / |
| Research Area | Cancer|Infection|Immunology/Inflammation |
| Molecular Formula | C15H12O |
| CAS# | 94-41-7 |
| Purity | ≥99% |
| SMILES | O=C(C1=CC=CC=C1)/C=C/C2=CC=CC=C2 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/chalcone.html |