Benzoyl Peroxide
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-05285 |
| Alternative Name(s) | Abcat 40;benzoic peroxyanhydride |
| Research Area | Benzoyl Peroxide is a widely used organic compound of the peroxide family. Benzoyl Peroxide is often used in acne treatments , bleaching and polymerizing polyester and many other uses. |
| Molecular Formula | C14H10O4 |
| CAS# | 94-36-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=CC=C1)OOC(C2=CC=CC=C2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST05285.html |
| Additional Information | NULL |