Chlorpropamide
API Standard
| Catalog Number | CS-O-01233 |
| Alternative Name(s) | 4-Chloro-N-[(propylamiben; hlorodiabina; Chloronase; Chloropropamide; Chlorpropamid; Chlorpropamide; Diabaril; Diabechlor; Diabenal; Diabenese; Glisema; Meldian; Melitase; Millinese; 1-(4-Chlorophenylsulfonyl)-3-propylurea |
| Research Area | Chlorpropamide is a sulfonylurea derivative. Chlorpropamide is a long acting hyopglycemic agent. Chlorpropamide is used in the treatment of diabetes metilus type 2. Chlorpropamide acts to increase the secretion of insulin and is not effective in patients |
| Molecular Formula | C10H13ClN2O3S |
| CAS# | 94-20-2 |
| Purity | >98% |
| SMILES | O=[S](NC(NCCC)=O)(C1=CC=C(Cl)C=C1)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01233.html |