Roxatidine Acetate hydrochloride
Roxatidine Acetate hydrochloride (HOE 760) is a specific and competitive histamin H2-receptor antagonist. It inhibits gastric acid secretion and ulcer formation.
| Catalog Number | T0157 |
| Alternative Name(s) | HOE 760 , Roxatidine Acetate HCl |
| Research Area | Neuroscience|||GPCR/G Protein|||Immunology/Inflammation |
| Molecular Formula | C19H29ClN2O4 |
| CAS# | 93793-83-0 |
| Purity | 99.61% |
| SMILES | Cl.CC(=O)OCC(=O)NCCCOc1cccc(CN2CCCCC2)c1 |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Roxatidine Acetate hydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T0157 |