Roxatidine Acetate HCl
Specific and competitive histamin H2-receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1565-5.1 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C19H28N2O4.HCl |
| CAS# | 93793-83-0 |
| Purity | 98.26% |
| SMILES | CC(=O)OCC(=O)NCCCOC1=CC=CC(=C1)CN2CCCCC2.Cl |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1565 |
