Pacritinib (SB1518) 25mg
Pacritinib, also known as SB1518, is an orally bioavailable inhibitor of Janus kinase 2 (JAK2) and the JAK2 mutant JAK2V617F with potential antineoplastic activity. Pacritinib competes with JAK2 for ATP binding, which may result in inhibition of JAK2 activation, inhibition of the JAK-STAT signaling pathway, and so caspase-dependent apoptosis.
| Trivial name | Pacritinib (SB1518) 25mg |
| Catalog Number | A12694-25 |
| Alternative Name(s) | 11-(2-pyrrolidin-1-yl-ethoxy)-14,19-dioxa-5,7,26-triaza-tetracyclo[19.3.1.1(2,6).1(8,12)]heptacosa-1(25),2(26),3,5,8,10,12(27),16,21,23-decaene |
| Molecular Formula | C28H32N4O3 |
| CAS# | 937272-79-2 |
| SMILES | C1CCN(C1)CCOC2=C3COC/C=C/COCC4=CC=CC(=C4)C5=NC(=NC=C5)NC(=C3)C=C2 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/pacritinib-sb1518.html |
