Pimelic Diphenylamide 106
Pimelic diphenylamide 106 is an inhibitor of class I HDAC with IC50 for HDAC1, HDAC2, and HDAC3 of 150 nM, 760nM, and 370 nM, respectively.
| Trivial name | RGFA-8; TC H-106; Histone Deacetylase Inhibitor VII |
| Catalog Number | CSN16486 |
| Alternative Name(s) | RGFA-8; TC H-106; Histone Deacetylase Inhibitor VII |
| Research Area | Neurological Disease |
| Molecular Formula | C20H25N3O2 |
| CAS# | 937039-45-7 |
| Purity | ≥99% |
| SMILES | O=C(NC1=CC=CC=C1N)CCCCCC(NC2=CC=C(C)C=C2)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/pimelic-diphenylamide-106.html |