8-Bromo-3-methyl-xanthine
8-Bromo-3,9-dihydro-3-methyl-1H-purine-2,6-dione, is a substituted derivative of of Xanthine, found in animal organs, yeast, potatoes, coffee beans, tea. It can also be used for the synthesis of Linagliptin, which is a novel potent and selective d
| Catalog Number | CS-O-32157 |
| Alternative Name(s) | 3-Methyl-8-bromoxanthine; 8-Bromo-3-methyl-3,7-dihydropurine-2,6-dione; 8-Bromo-3-methylxanthine |
| Research Area | Intermediates |
| Molecular Formula | C6H5BrN4O2 |
| CAS# | 93703-24-3 |
| Purity | >98% |
| SMILES | CN(C(N1)=O)C(NC(Br)=N2)=C2C1=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO32157.html |