OSI-027 100mg
OSI-027 is a potent, selective and orally bioavailable mTOR kinase inhibitor that inhibits the kinase activity associated with both the TORC1 and TORC2 complexes of mTOR.
| Trivial name | OSI-027 100mg |
| Catalog Number | A11056-100 |
| Alternative Name(s) | 4-(4-amino-5-(7-methoxy-1H-indol-2-yl)imidazo[5,1-f][1,2,4]triazin-7-yl)cyclohexanecarboxylic acid hydrochloride |
| Molecular Formula | C21H22N6O3 |
| CAS# | 936890-98-1 |
| SMILES | COC1=CC=CC2=C/C(=C/3C4=C(N=CNN4C(=N3)C5CCC(CC5)C(=O)O)N)/N=C21 |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/osi-027.html |