AZD1480 10mM * 1mL in DMSO
AZD1480 is a novel potent small JAK2 inhibitor with an IC50 of 0.26 nM.
| Trivial name | AZD1480 10mM * 1mL in DMSO |
| Catalog Number | A10110-10mM-D |
| Alternative Name(s) | 5-Chloro-N2-[(1S)-1-(5-fluoro-2-pyrimidinyl)ethyl]-N4-(5-methyl-1H-pyrazol-3-yl)-2,4-pyrimidinediamine |
| Molecular Formula | C14H14ClFN8 |
| CAS# | 935666-88-9 |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC=C2Cl)N[C@@H](C)C3=NC=C(C=N3)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/azd1480.html |
