Visomitin (SKQ1)
Visomitin (SKQ1) is a novel mitochondrial-targeted antioxidant that holds promise in the treatment of inflammation associated with ocular surface diseases such as dry eye disease (DED) and corneal wounds. SkQ1 shows a TC50 of 317 nM on HCjE cells.
| Trivial name | N/A |
| Catalog Number | S9729 |
| Molecular Formula | C36H42BrO2P |
| CAS# | 934826-68-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Br-].CC1=C(C)C(=O)C(=CC1=O)CCCCCCCCCC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/visomitin-skq1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9729-visomitin-skq1-chemical-structure.gif |