ENMD-2076 5mg
ENMD-2076 is a novel, orally-active antimitotic and antiangiogenic molecule inhibits Aurora A as well as tyrosine kinases that drive tumor vascularization, including VEGFR2 (KDR), PDGFR and the FGF receptors.
| Trivial name | ENMD-2076 5mg |
| Catalog Number | A10352-5 |
| Alternative Name(s) | (E)-N-(5-methyl-1H-pyrazol-3-yl)-6-(4-methylpiperazin-1-yl)-2-styrylpyrimidin-4-amine |
| Molecular Formula | C21H25N7 |
| CAS# | 934353-76-1, 1291074-87-7 |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC(=C2)N3CCN(CC3)C)/C=C/C4=CC=CC=C4 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/enmd-2076.html |
