Rabeprazole D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-60935 |
| Alternative Name(s) | 2-{[4-(3-methoxypropoxy)-3-methylpyridin-2- yl]methanesulfinyl}(4,5,6,7-²H4)-1H-1,3- benzodiazole |
| Research Area | Rabeprazole-d4 is the labeled analogue of Rabeprazole , a partially reversible gastric proton pump inhibitor. |
| Molecular Formula | NULL |
| CAS# | 934295-48-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](C(NC1=C(C([2H])=C2[2H])[2H])=NC1=C2[2H])CC(N=CC=C3OCCCOC)=C3C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST60935.html |
| Additional Information | NULL |