A-966492 5mg
A-966492 displayed high potency against the poly(ADP-ribose) polymerase-1 (PARP-1) enzyme with a K(i) of 1 nM and an EC(50) of 1 nM in a whole cell assay.
| Trivial name | A-966492 5mg |
| Catalog Number | A10019-5 |
| Alternative Name(s) | 2-[2-Fluoro-4-[(2S)-2-pyrrolidinyl]phenyl]-1H-benzimidazole-7-carboxamide |
| Molecular Formula | C18H17FN4O |
| CAS# | 934162-61-5 |
| SMILES | C1CC(NC1)C2=CC(=C(C=C2)C3=NC4=C(C=CC=C4N3)C(=O)N)F |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/a-966492.html |
