Ciprofloxacin (CPX) hydrochloride
Ciprofloxacin (CPX) hydrochloride, a fluorinated quinolone, is a β-diketone antibiotic with a broad spectrum antibacterial activity. Ciprofloxacin is an inhibitor of bacterial DNA gyrase (a subclass of Type II topoisomerases).
| Trivial name | Bay-09867 |
| Catalog Number | S5008 |
| Molecular Formula | C17H19ClFN3O3 |
| CAS# | 93107-08-5 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | Cl.OC(=O)C1=CN(C2CC2)C3=CC(=C(F)C=C3C1=O)N4CCNCC4 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/ciprofloxacin-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5008-ciprofloxacin-hydrochloride-chemical-structure.gif |