4-Chloro-N-(1-(4-nitrophenethyl)piperidin-2-ylidene)benzenesulfonamide
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-06309 |
| Alternative Name(s) | 4chloro-a,a,a-trifluoro-m-toluidine, 5-Amino-2chlorobenzotrifluoride;4-chloro-N-(1-(4-nitrophenethyl)piperidin-2-ylidene)benzenesulfonamide |
| Research Area | It is an analog of the opioid receptor agonist fentanyl. It has been shown to be a potent analg |
| Molecular Formula | NULL |
| CAS# | 93101-02-01 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](/N=C1N(CCCC1)CCC2=CC=C([N](=O)=O)C=C2)(C3=CC=C(Cl)C=C3)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06309.html |
| Additional Information | NULL |