Isoeugenol methyl ether
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30607 |
| Alternative Name(s) | 1,2-Dimethoxy-4-propenylbenzene, Isoeugenyl methyl ether |
| Research Area | Methyleugenol is a yellowish, oily, naturally occurring liquid with a clove-like aroma and is present in many essential oils. Methyleugenol is used as a flavoring agent, as a fragrance and as an anesthetic in rodents. Methyleugenol is mutagenic in animals |
| Molecular Formula | C11H14O2 |
| CAS# | 93-16-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC(C=C(/C=C/C)C=C1)=C1OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30607.html |
| Additional Information | NULL |