SB939 10mM * 1mL in DMSO
SB939 is an oral inhibitor of HDAC, selective for class I, II and IV HDACs and displays an IC50 value of 77 nM in an in vitro HDAC1 activity assay.
| Trivial name | SB939 10mM * 1mL in DMSO |
| Catalog Number | A10830-10mM-D |
| Alternative Name(s) | 3-?€?[2-?€?butyl-?€?1-?€?[2-?€?(diethylamino)ethyl]-?€?1H-?€?benzimidazol-?€5-?€?yl]-?€?N-?€?hydroxy-?€?2E-?€?propenamide |
| Molecular Formula | C20H30N4O2 |
| CAS# | 929016-96-6 |
| SMILES | CCCCC1=NC2=C(N1CCN(CC)CC)C=CC(=C2)/C=C/C(=O)NO |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sb939.html |
