Iothalamic Acid D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-56766 |
| Alternative Name(s) | Methalamic Acid-d3;3-(Acetylamino)-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoic Acid-d3; 5-Acetamido-2,4,6-triiodo-N-methylisophthalamic Acid-d3; 5-Acetylamino-2,4,6-triiodo-N-methyl-3-isophthalamic Acid-d3; |
| Research Area | Labelled Iothalamic Acid is used as a contrast medium in diagnostic radiology. Iothalamic Acid displayed the same level of nephrotoxicity against rat and human renal epithelial cells as conventional ionic contrast medioum. |
| Molecular Formula | NULL |
| CAS# | 928623-31-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(I)=C(NC(C([2H])([2H])[2H])=O)C(I)=C1C(O)=O)=C1I)NC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST56766.html |
| Additional Information | NULL |