E-7050 (Golvatinib) 10mg
E7050 (also known as golvatinib is an orally bioavailable dual kinase inhibitor of c-Met (hepatocyte growth factor receptor) and VEGFR-2 (vascular endothelial growth factor receptor-2) tyrosine kinases with potential antineoplastic activity.
| Trivial name | E-7050 (Golvatinib) 10mg |
| Catalog Number | A11396-10 |
| Alternative Name(s) | N-(2-fluoro-4-((2-(4-(4-methylpiperazin-1-yl)piperidine-1-carboxamido)pyridin-4-yl)oxy)phenyl)-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| Molecular Formula | C33H37F2N7O4 |
| CAS# | 928037-13-2 |
| SMILES | CN1CCN(CC1)C2CCN(CC2)C(=O)NC3=NC=CC(=C3)OC4=CC(=C(C=C4)NC(=O)C5(CC5)C(=O)NC6=CC=C(C=C6)F)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/e-7050-golvatinib.html |
