RAF265 10mg
RAF265 (CHIR-265) is an oral, highly selective RAF and VEGFR kinase inhibitor, which is to control or normalize VEGFR-2 along with the inhibition of B-raf and c-Raf mutation to prevent cancers.
| Trivial name | RAF265 10mg |
| Catalog Number | A10773-10 |
| Alternative Name(s) | 1-Methyl-5-[[2-[5-(trifluoromethyl)-1H-imidazol-2-yl]-4-pyridinyl]oxy]-N-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-2-amine |
| Molecular Formula | C24H16F6N6O |
| CAS# | 927880-90-8 |
| SMILES | CN1C2=C(C=C(C=C2)OC3=CC(=NC=C3)C4=NC=C(N4)C(F)(F)F)N=C1NC5=CC=C(C=C5)C(F)(F)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/raf265-chir-265.html |
