KC7F2 100mg
KC7F2 is an inhibitor of HIF-1?? protein translation, but not transcription, that suppresses phosphorylation of two key regulators of protein synthesis, eukaryotic translation initiation factor 4E binding protein 1 (4EBP1) and p70 S6 kinase (S6K).
| Trivial name | KC7F2 100mg |
| Catalog Number | A15359-100 |
| Alternative Name(s) | 2,5-dichloro-N-[2-[2-[(2,5-dichlorophenyl)sulfonylamino]ethyldisulfanyl]ethyl]benzenesulfonamide |
| Molecular Formula | C16H16Cl4N2O4S4 |
| CAS# | 927822-86-4 |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)NCCSSCCNS(=O)(=O)C2=C(C=CC(=C2)Cl)Cl)Cl |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/kc7f2.html |
