6-FAM SE
6-FAM SE is an amine-reactive succinimidyl ester carboxyfluorescein that yields carboxyamides which are more resistant to hydrolysis than fluorescein conjugates prepared with FITC.
| Trivial name | 6-Carboxyfluorescein N-Hydroxysuccinimide Ester |
| Catalog Number | CSN10142 |
| Alternative Name(s) | 6-Carboxyfluorescein N-Hydroxysuccinimide Ester |
| Research Area | / |
| Molecular Formula | C25H15NO9 |
| CAS# | 92557-81-8 |
| Purity | ≥98% |
| SMILES | O=C1OC2(C3=C(OC4=C2C=CC(O)=C4)C=C(O)C=C3)C5=C1C=CC(C(ON6C(CCC6=O)=O)=O)=C5 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/6-fam-se.html |