Simeprevir
Simeprevir is a competitive, reversible, macrocyclic, noncovalent hepatitis C virus (HCV) NS3/4A protease inhibitor that acts directly against the hepatitis C virus. It has a medium inhibitory concentration (IC50) <13 nM for all HCV NS3/4A enzymes(genotypes 1a, 1b, 2, 4, 5, and 6), but has an IC50 value of 37 nM for genotype 3.
| Trivial name | TMC435, TMC-435350 |
| Catalog Number | S5015 |
| Molecular Formula | C24H22FN3O4.CH4O3S |
| CAS# | 923604-59-5 |
| SMILES | CCC1(O)C(=O)OCC2=C1C=C3N(CC4=C5C(N)CCC6=C5C(=CC(=C6C)F)N=C34)C2=O.C[S](O)(=O)=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/simeprevir.html |
| Additional Information | https://file.selleck.cn/downloads/struct/simeprevir-chemical-structure-s5015.gif |
