Navitoclax (ABT-263)
Navitoclax (ABT-263) is a potent inhibitor of Bcl-xL, Bcl-2 and Bcl-w with Ki of ≤ 0.5 nM, ≤1 nM and ≤1 nM in cell-free assays, but binds more weakly to Mcl-1 and A1. Phase 2.
| Trivial name | N/A |
| Catalog Number | S1001 |
| Molecular Formula | C22H20BrN3O3S |
| CAS# | 923564-51-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC(=CC=C1)C2=NN(C(C2)C3=CC=C(Br)C=C3)C4=CC=C(C=C4)[S](N)(=O)=O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/ABT-263.html |
| Additional Information | https://file.selleck.cn/downloads/struct/ABT-263-chemical-structure-S1001.gif |
