ABT-263 (Navitoclax) 10mM * 1mL in DMSO
ABT-263 (Navitoclax) is a potent orally bioavailable SMI that is structurally related to ABT-737. ABT-263 disrupts Bcl-2 – Bcl-XL interactions with pro-apoptotic proteins .
| Trivial name | ABT-263 (Navitoclax) 10mM * 1mL in DMSO |
| Catalog Number | A10022-10mM-D |
| Alternative Name(s) | (R)-4-(4-((4'-chloro-4,4-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-yl)methyl)piperazin-1-yl)-N-((4-((4-morpholino-1-(phenylthio)butan-2-yl)amino)-3-((trifluoromethyl)sulfonyl)phenyl)sulfonyl)benzamide |
| Molecular Formula | C47H55ClF3N5O6S3 |
| CAS# | 923564-51-6 |
| SMILES | CC1(CCC(=C(C1)CN2CCN(CC2)C3=CC=C(C=C3)C(=O)NS(=O)(=O)C4=CC(=C(C=C4)N[C@H](CCN5CCOCC5)CSC6=CC=CC=C6)S(=O)(=O)C(F)(F)F)C7=CC=C(C=C7)Cl)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/abt-263-navitoclax.html |
