Refametinib 10mM * 1mL in DMSO
Refametinib is a potent, ATP non-competitive and highly selective inhibitor of MEK1 and MEK2 with IC50 of 19 nM and 47 nM, respectively.
| Trivial name | Refametinib 10mM * 1mL in DMSO |
| Catalog Number | A11264-10mM-D |
| Alternative Name(s) | (S)-N-(3,4-difluoro-2-(2-fluoro-4-iodophenylamino)-6-methoxyphenyl)-1-(2,3-dihydroxypropyl)cyclopropane-1-sulfonamide |
| Molecular Formula | C19H20F3IN2O5S |
| CAS# | 923032-37-5 |
| SMILES | COC1=CC(=C(C(=C1NS(=O)(=O)C2(CC2)C[C@@H](CO)O)NC3=C(C=C(C=C3)I)F)F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/refametinib.html |
