Kazusamycin A | MedChemExpress (MCE)
Kazusamycin A (PD-114721) is an antitumor antibiotic. Kazusamycin A can be isolated from fermentation beers of a previously unknown actinomycete[1].
| Trivial name | Kazusamycin A |
| Catalog Number | HY-130044 |
| Alternative Name(s) | PD-114721 |
| Research Area | Cancer |
| CAS# | 92090-94-3 |
| Purity | ≥98.00% |
| SMILES | OC(/C=C(C)/C[C@H](C)[C@@H](O)[C@H](C)C([C@H](CO)/C=C(C)/C=C/C[C@@H](C)/C=C(CC)\C=C\[C@H]1[C@H](C=CC(O1)=O)C)=O)=O |
| PubChem Chemical Structure ID | 11272917 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kazusamycin-a.html |