Influenza Hemagglutinin (HA) Peptide
Influenza Hemagglutinin (HA) peptide is a synthetic peptide that corresponds to amino acids 98-106 of the human influenza virus hemagglutinin. The HA Peptide is used for competing out the anti-HA antibody binding to HA-tagged fusion proteins in immunoassays. attaching the virus to cell receptors and for initiating infection.
| Catalog Number | R1854 |
| Alternative Name(s) | HA Peptide |
| Research Area | Suitable for use in immunoblotting and when used to elute HA-tagged fusion proteins from an affinity column of Monoclonal Anti-HA agarose. |
| Molecular Formula | C53H67N9O17 |
| CAS# | 92000-76-5 |
| Purity | >97% |
| Inchi | InChI=1S/C53H67N9O17/c1-27(2)44(52(77)62-21-5-7-41(62)50(75)59-38(25-42(66)67)47(72)56-36(45(70)55-28(3)53(78)79)23-30-10-16-33(64)17-11-30)60-48(73)39(26-43(68)69)57-46(71)37(24-31-12-18-34(65)19-13-31)58-49(74)40-6-4-20-61(40)51(76)35(54)22-29-8-14-32(63)15-9-29/h8-19,27-28,35-41,44,63-65H,4-7,20-26,54H2,1-3H3,(H,55,70)(H,56,72)(H,57,71)(H,58,74)(H,59,75)(H,60,73)(H,66,67)(H,68,69)(H,78,79)/t28-,35-,36-,37-,38-,39-,40-,41-,44-/m0/s1 |
| Inchi Key | HVLSXIKZNLPZJJ-TXZCQADKSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]2CCCN2C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC3=CC=C(C=C3)O)NC(=O)[C@@H]4CCCN4C(=O)[C@H](CC5=CC=C(C=C5)O)N |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/influenza-hemagglutinin-ha-peptide-item-r1854-39458.html |