4-Acetylbiphenyl | MedChemExpress (MCE)
4-Acetylbiphenyl (ACBP) is a biphenyl compound that can be used as a probe molecule to study the structure and function of proteins and to study the properties of lipid membranes[1].
| Trivial name | 4-Acetylbiphenyl |
| Catalog Number | HY-W009877 |
| Research Area | Others |
| CAS# | 92-91-1 |
| Purity | ≥98.0% |
| SMILES | O=C(C)C1=CC=C(C2=CC=CC=C2)C=C1 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/4-acetylbiphenyl.html |