p-Cresyl sulfate potassium
p-Cresyl sulfate potassium is a uremic toxin that binds to a prototype protein. p-Cresyl sulfate potassium activates the JNK and p38 MAPK signaling pathways. p-Cresyl sulfate potassium has pro-inflammatory activity.
| Trivial name | p-Tolyl sulfate potassium |
| Catalog Number | E7497 |
| Molecular Formula | C9H7Cl2N5 |
| CAS# | 91978-69-7 |
| Inchi | InChI=1S/C9H7Cl2N5/c10-4-1-2-6(11)5(3-4)7-14-8(12)16-9(13)15-7/h1-3H,(H4,12,13,14,15,16) |
| Inchi Key | ATCGGEJZONJOCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=NC(=NC(=N2)N)N)Cl |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/p-cresyl-sulfate-potassium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7497-p-cresyl-sulfate-potassium-chemical-structure-tube.png |
