PLX4032 10mM * 1mL in DMSO
PLX4032 (Vemurafenib) also known as RG7204, Vemurafenib, R7204; RO5185426. PLX4032 is a B-raf inhibitor with an IC50 of 44 nM.
Trivial name | PLX4032 10mM * 1mL in DMSO |
Catalog Number | A10739-10mM-D |
Alternative Name(s) | N-[2,4-Difluoro-3-[[5-(3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]carbonyl]phenyl]-2-propanesulfonamide |
Molecular Formula | C23H18ClF2N3O3S |
CAS# | 918504-65-1 |
SMILES | CCCS(=O)(=O)NC1=C(C(=C(C=C1)F)C(=O)C2=CNC3=NC=C(C=C23)C4=CC=C(C=C4)Cl)F |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/plx4032-vemurafenib.html |