CYT997 50mg
CYT997 is a novel anti-cancer vascular disrupting agent (VDA). In vitro, CYT997 is shown to potently inhibit the proliferation of vascular endothelial growth factor-stimulated human umbilical vein endothelial cells (IC(50) 3.7 ?? 1.8 nM) and cause significant morphological changes at 100 nM, including membrane blebbing.
| Trivial name | CYT997 50mg |
| Catalog Number | A10264-50 |
| Alternative Name(s) | N-Ethyl-N'-[2-methoxy-4-[5-methyl-4-[[(1S)-1-(3-pyridinyl)butyl]amino]-2-pyrimidinyl]phenyl]urea |
| Molecular Formula | C24H30N6O2 |
| CAS# | 917111-44-5 |
| SMILES | CCC[C@@H](C1=CN=CC=C1)NC2=NC(=NC=C2C)C3=CC(=C(C=C3)NC(=O)NCC)OC |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/cyt997.html |
