Amphethinile
Amphethinile is an anti-tubulin agent and a novel anti-mitotic agent. The affinity constant for the association (Ka) of Amphethinile with tubulin is 1.3 μM.
| Trivial name | Amphetinile; CRC 82-07 |
| Catalog Number | CSN22155 |
| Alternative Name(s) | Amphetinile; CRC 82-07 |
| Research Area | Cancer |
| Molecular Formula | C15H11N3S |
| CAS# | 91531-98-5 |
| Purity | ≥98% |
| SMILES | N#CC1=C(N)NC2=C1C=C(SC3=CC=CC=C3)C=C2 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/amphethinile.html |