INCB024360 analog 10mM * 1mL in DMSO
INCB024360 is an orally available hydroxyamidine and inhibitor of indoleamine 2,3-dioxygenase (IDO1), with potential immunomodulating and antineoplastic activities.
| Trivial name | INCB024360 analog 10mM * 1mL in DMSO |
| Catalog Number | A13004-10mM-D |
| Alternative Name(s) | 4-amino-N-(3-chloro-4-fluorophenyl)-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| Molecular Formula | C9H7ClFN5O2 |
| CAS# | 914471-09-3 |
| SMILES | C1=CC(=C(C=C1N/C(=C2/C(=NON2)N)/N=O)Cl)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/incb024360.html |
