PluriSln 1 10mg
stearoyl-CoA desaturase 1 (SCD1) inhibitor. Used to selectively eliminate undifferentiated human pluripotent stem cells (hPSCs) from culture; induces ER stress, attenuates protein synthesis and induces apoptosis in hPSCs. Prevents teratoma formation in immunocompromised mice.
| Trivial name | PluriSln 1 10mg |
| Catalog Number | A12899-10 |
| Alternative Name(s) | 4-Pyridinecarboxylic acid 2-phenylhydrazide |
| Molecular Formula | C12H11N3O |
| CAS# | 91396-88-2 |
| SMILES | C1=CC=C(C=C1)NNC(=O)C2=CC=NC=C2 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/plurisln-1.html |
