Lu AA47070 | MedChemExpress (MCE)
Lu AA47070 is a phosphonooxymethylene prodrug of a potent and selective Adenosine A2A receptor antagonist. Lu AA47070 reverses the motor and motivational effects produced by dopamine D2 receptor blockade[1][2].
| Trivial name | Lu AA47070 |
| Catalog Number | HY-14408 |
| Research Area | Neurological Disease |
| CAS# | 913842-25-8 |
| Purity | ≥98.00% |
| SMILES | O=P(O)(O)OCN1C=CS/C1=N\C(C2=CC(F)=C(NC(CC(C)(C)C)=O)C(F)=C2)=O |
| PubChem Chemical Structure ID | 11947802 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lu-aa47070.html |