AMG-458 10mM * 1mL in DMSO
AMG-458 is a potent inhibitor of c-Met with an IC50 value of 60nM and displays selectivity against VEGFR2.
| Trivial name | AMG-458 10mM * 1mL in DMSO |
| Catalog Number | A11055-10mM-D |
| Alternative Name(s) | {1-(2-hydroxy-2-methylpropyl)-N-[5-(7-methoxyquinolin-4-yloxy)pyridin-2-yl]-5-met hyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazole-4-carboxamide} |
| Molecular Formula | C30H29N5O5 |
| CAS# | 913376-83-7 |
| SMILES | CC1=C(C(=O)N(N1CC(C)(C)O)C2=CC=CC=C2)C(=O)NC3=NC=C(C=C3)OC4=C5C=CC(=CC5=NC=C4)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/amg-458.html |